Loading Port:Qingdao
Payment Terms:TT OR LC
Min Order Qty:1 m.t.
Supply Capability:1000 m.t./month
Acetic Acid
Popular name: Acetic acid & Glacial acetic acid &Acetic acid glacial
CAS NO.: 64-19-7
EINECS: 200-580-7
Molecular formula: C2H4O2 ,CH3COOH
Formula weight: 60.05
InChI: InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
Melting point: 16.6 ℃
Density: 1.05
Water-solubility: SOLUBLE
Physicochemical properties:
1. Colorless liquid and irritating dour.
2. Melting point 16.6 ℃; boiling point 117.9℃; Flash point : 39 ℃.
3. Solubility water, ethanol, benzene and ethyl ether immiscible, insoluble in carbon disulphide.
Packing details:
20kg/drum,21MT-23MT/20FCL;
25kg/drum, 22.5MT-24MT/20FCL;
30kg/drum, 21MT-21.6MT/20FCL;
220kg/drum, 16MT-17.6MT/20FCL;
IBC 1050kg, 21MT/20FCL.
Use:
1. Water treatment
2. Construction
3. Textile dyeing
4. Pharmaceutical
5. Chemical industry
6. Synthetic fiber
7. Paint
8. Plastic , etc.
Safety Terms:
S23: Do not breathe vapour.
S26: In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S45: In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible).
Risk terms:
R10. Flammable
R35. Causes severe burns
Dangerous signs:
Upstream product:
Butyric acid, methanol, natural gas, oxygen, ethanol, acetaldehyde, ethylene
Downstream products:
Porous ammonium nitrate, sulfur, ammonia (industrial), oxygen indene, 2-amino-4-acetamido anisole, monochloroacetic acid, 1,4-benzenedicarboxylic acid, 1,3-phthalic acid, glycine , glyceryl triacetate, ethylene glycol ethyl ether acetate, ethyl acetate, vinyl acetate, butyl acetate, isopropyl acetate.
Molecular structure:
| ANALSIS ITEMS | UNIT | SEPCIFICATION | RESULT(#1) |
|---|---|---|---|
| Appearance | - | clear | clear |
| Apha’color | - | MAX5 | 3 |
| Purity | Wt% | MIN 99.8 | 99.86 |
| Density(20℃) | g/ml | 1.048~1.051 | |
| Freezing point | ℃ | Min 16.35 | 16.37 |
| Chloride | ppm | N/L | N/L |
| Sulfate(as SO4) | ppm | N/L | N/L |
| Iron(Fe) | ppm | Max 0.4 | 0.1 |
| Heavy Metal | ppm | Max 0.5 | 0.005 |
| Water | Wt% | Max 8 | 0.1 |
| Aldehyde (as CH3CHO) | ppm | Max 50 | 10 |
| Formic acid | Wt% | Max 0.05 | 0.001 |
| Permanganate time | Hr | Min 2 | MIN2 |
| Non-volatile matter | % | Max 0.003 | 0.001 |
| Distillation range | ℃ | 117.5~119.0 | 117.5~118.9 |
